C13H17ClF3N3O — CID 106767839
6-chloro-N-(2-cyclohexyloxyethyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106767839) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is 6-chloro-N-(2-cyclohexyloxyethyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-cyclohexyloxyethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106767839 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 6-chloro-N-(2-cyclohexyloxyethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1nc(Cl)cc(NCCOC2CCCCC2)n1 |
| InChI | InChI=1S/C13H17ClF3N3O/c14-10-8-11(20-12(19-10)13(15,16)17)18-6-7-21-9-4-2-1-3-5-9/h8-9H,1-7H2,(H,18,19,20) |
| InChIKey | RMXJQZSJKDNOPG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|