C10H13ClF3N3O — CID 107318321
5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol (PubChem CID 107318321) has the molecular formula C10H13ClF3N3O and a molecular weight of 283.68 g/mol. Its IUPAC name is 5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol.
| Compound Name | 5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107318321 |
| Molecular Formula | C10H13ClF3N3O |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol |
| SMILES | OCCCCCNc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13ClF3N3O/c11-7-6-8(15-4-2-1-3-5-18)17-9(16-7)10(12,13)14/h6,18H,1-5H2,(H,15,16,17) |
| InChIKey | NVGLJOHBIXETKK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|