C13H20ClF3N4 — CID 106767627
N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 106767627) has the molecular formula C13H20ClF3N4 and a molecular weight of 324.78 g/mol. Its IUPAC name is N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine.
| Compound Name | N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 106767627 |
| Molecular Formula | C13H20ClF3N4 |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CC(C)N(C)CCCCNc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H20ClF3N4/c1-9(2)21(3)7-5-4-6-18-11-8-10(14)19-12(20-11)13(15,16)17/h8-9H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | SVJFHAZAOLICIJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|