C16H31N5 — CID 80967129
2-tert-butyl-4-N-[4-[methyl(propan-2-yl)amino]butyl]pyrimidine-4,6-diamine (PubChem CID 80967129) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-tert-butyl-4-N-[4-[methyl(propan-2-yl)amino]butyl]pyrimidine-4,6-diamine.
| Compound Name | 2-tert-butyl-4-N-[4-[methyl(propan-2-yl)amino]butyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80967129 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 2-tert-butyl-4-N-[4-[methyl(propan-2-yl)amino]butyl]pyrimidine-4,6-diamine |
| SMILES | CC(C)N(C)CCCCNc1cc(N)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C16H31N5/c1-12(2)21(6)10-8-7-9-18-14-11-13(17)19-15(20-14)16(3,4)5/h11-12H,7-10H2,1-6H3,(H3,17,18,19,20) |
| InChIKey | NUTRTLMLOKZZCM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|