C10H16F2N4 — CID 115409403
2-tert-butyl-4-N-(2,2-difluoroethyl)pyrimidine-4,6-diamine (PubChem CID 115409403) has the molecular formula C10H16F2N4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-tert-butyl-4-N-(2,2-difluoroethyl)pyrimidine-4,6-diamine.
| Compound Name | 2-tert-butyl-4-N-(2,2-difluoroethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115409403 |
| Molecular Formula | C10H16F2N4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-tert-butyl-4-N-(2,2-difluoroethyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)(C)c1nc(N)cc(NCC(F)F)n1 |
| InChI | InChI=1S/C10H16F2N4/c1-10(2,3)9-15-7(13)4-8(16-9)14-5-6(11)12/h4,6H,5H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | VEWZENXBOUYNNZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |