C10H15F3N4O — CID 106773118
1-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol (PubChem CID 106773118) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is 1-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol.
| Compound Name | 1-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 106773118 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)CNc1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N4O/c1-5(2)6(18)4-15-8-3-7(14)16-9(17-8)10(11,12)13/h3,5-6,18H,4H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | ICQGQIGMLKMXJU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |