C9H13F3N4O2 — CID 106771755
2-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethoxy]ethanol (PubChem CID 106771755) has the molecular formula C9H13F3N4O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 2-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 106771755 |
| Molecular Formula | C9H13F3N4O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethoxy]ethanol |
| SMILES | Nc1cc(NCCOCCO)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H13F3N4O2/c10-9(11,12)8-15-6(13)5-7(16-8)14-1-3-18-4-2-17/h5,17H,1-4H2,(H3,13,14,15,16) |
| InChIKey | JHYFIEKMNIKQKC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|