C8H12F3N5O2S — CID 106770814
N-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 106770814) has the molecular formula C8H12F3N5O2S and a molecular weight of 299.28 g/mol. Its IUPAC name is N-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 106770814 |
| Molecular Formula | C8H12F3N5O2S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-[2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H12F3N5O2S/c1-19(17,18)14-3-2-13-6-4-5(12)15-7(16-6)8(9,10)11/h4,14H,2-3H2,1H3,(H3,12,13,15,16) |
| InChIKey | MJRYBICPTIUVMS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|