C12H23N5O2S — CID 106343345
2-[(6-amino-2-tert-butylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide (PubChem CID 106343345) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-[(6-amino-2-tert-butylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(6-amino-2-tert-butylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106343345 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[(6-amino-2-tert-butylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1cc(N)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H23N5O2S/c1-5-15-20(18,19)7-6-14-10-8-9(13)16-11(17-10)12(2,3)4/h8,15H,5-7H2,1-4H3,(H3,13,14,16,17) |
| InChIKey | WEHBKCYWRMCICA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |