C10H18N4O3S — CID 106334265
2-[(5-amino-6-methoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide (PubChem CID 106334265) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-[(5-amino-6-methoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(5-amino-6-methoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106334265 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[(5-amino-6-methoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1ccc(N)c(OC)n1 |
| InChI | InChI=1S/C10H18N4O3S/c1-3-13-18(15,16)7-6-12-9-5-4-8(11)10(14-9)17-2/h4-5,13H,3,6-7,11H2,1-2H3,(H,12,14) |
| InChIKey | UUUVCTVZRYEKIO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |