C12H22N4O3S — CID 106334326
2-[(5-amino-6-propoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide (PubChem CID 106334326) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[(5-amino-6-propoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(5-amino-6-propoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106334326 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[(5-amino-6-propoxy-2-pyridinyl)amino]-N-ethylethanesulfonamide |
| SMILES | CCCOc1nc(NCCS(=O)(=O)NCC)ccc1N |
| InChI | InChI=1S/C12H22N4O3S/c1-3-8-19-12-10(13)5-6-11(16-12)14-7-9-20(17,18)15-4-2/h5-6,15H,3-4,7-9,13H2,1-2H3,(H,14,16) |
| InChIKey | JNNVPUJQPNMBOC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |