C15H27N3O — CID 115324707
2-N-(5-methylhexyl)-6-propoxypyridine-2,5-diamine (PubChem CID 115324707) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-N-(5-methylhexyl)-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-(5-methylhexyl)-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 115324707 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-N-(5-methylhexyl)-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NCCCCC(C)C)ccc1N |
| InChI | InChI=1S/C15H27N3O/c1-4-11-19-15-13(16)8-9-14(18-15)17-10-6-5-7-12(2)3/h8-9,12H,4-7,10-11,16H2,1-3H3,(H,17,18) |
| InChIKey | FKFJAHQSQXUTGF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|