C16H29N3O — CID 115324708
2-N-(5-methylhexyl)-6-(2-methylpropoxy)pyridine-2,5-diamine (PubChem CID 115324708) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-N-(5-methylhexyl)-6-(2-methylpropoxy)pyridine-2,5-diamine.
| Compound Name | 2-N-(5-methylhexyl)-6-(2-methylpropoxy)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 115324708 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 2-N-(5-methylhexyl)-6-(2-methylpropoxy)pyridine-2,5-diamine |
| SMILES | CC(C)CCCCNc1ccc(N)c(OCC(C)C)n1 |
| InChI | InChI=1S/C16H29N3O/c1-12(2)7-5-6-10-18-15-9-8-14(17)16(19-15)20-11-13(3)4/h8-9,12-13H,5-7,10-11,17H2,1-4H3,(H,18,19) |
| InChIKey | QZTJNSMVRJYSSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|