C13H20F3N3O — CID 115515323
6-(2-methylpropoxy)-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-diamine (PubChem CID 115515323) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is 6-(2-methylpropoxy)-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-diamine.
| Compound Name | 6-(2-methylpropoxy)-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 115515323 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6-(2-methylpropoxy)-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-diamine |
| SMILES | CC(C)COc1nc(NCCCC(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H20F3N3O/c1-9(2)8-20-12-10(17)4-5-11(19-12)18-7-3-6-13(14,15)16/h4-5,9H,3,6-8,17H2,1-2H3,(H,18,19) |
| InChIKey | SVFVEDULZBHUOD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|