C12H21N3O2 — CID 114146045
5-[(5-amino-6-ethoxy-2-pyridinyl)amino]pentan-2-ol (PubChem CID 114146045) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-[(5-amino-6-ethoxy-2-pyridinyl)amino]pentan-2-ol.
| Compound Name | 5-[(5-amino-6-ethoxy-2-pyridinyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 114146045 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 5-[(5-amino-6-ethoxy-2-pyridinyl)amino]pentan-2-ol |
| SMILES | CCOc1nc(NCCCC(C)O)ccc1N |
| InChI | InChI=1S/C12H21N3O2/c1-3-17-12-10(13)6-7-11(15-12)14-8-4-5-9(2)16/h6-7,9,16H,3-5,8,13H2,1-2H3,(H,14,15) |
| InChIKey | FUCNPFGSXYEULK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|