C11H20N4O — CID 43260939
2-N-[2-(dimethylamino)ethyl]-6-ethoxypyridine-2,5-diamine (PubChem CID 43260939) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-6-ethoxypyridine-2,5-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-6-ethoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 43260939 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-6-ethoxypyridine-2,5-diamine |
| SMILES | CCOc1nc(NCCN(C)C)ccc1N |
| InChI | InChI=1S/C11H20N4O/c1-4-16-11-9(12)5-6-10(14-11)13-7-8-15(2)3/h5-6H,4,7-8,12H2,1-3H3,(H,13,14) |
| InChIKey | SHGSEOFLIMHDOZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |