C13H24N4O — CID 43261174
2-N-[3-(dimethylamino)propyl]-6-propoxypyridine-2,5-diamine (PubChem CID 43261174) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 43261174 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NCCCN(C)C)ccc1N |
| InChI | InChI=1S/C13H24N4O/c1-4-10-18-13-11(14)6-7-12(16-13)15-8-5-9-17(2)3/h6-7H,4-5,8-10,14H2,1-3H3,(H,15,16) |
| InChIKey | JUCXOHMWHKOSMG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|