C16H28N4O — CID 61239615
2-N-[2-(azepan-1-yl)ethyl]-6-propoxypyridine-2,5-diamine (PubChem CID 61239615) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-N-[2-(azepan-1-yl)ethyl]-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-[2-(azepan-1-yl)ethyl]-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 61239615 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 2-N-[2-(azepan-1-yl)ethyl]-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NCCN2CCCCCC2)ccc1N |
| InChI | InChI=1S/C16H28N4O/c1-2-13-21-16-14(17)7-8-15(19-16)18-9-12-20-10-5-3-4-6-11-20/h7-8H,2-6,9-13,17H2,1H3,(H,18,19) |
| InChIKey | AUOBUYLIZDFSIF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |