C11H19N3O — CID 43260874
2-N-propan-2-yl-6-propoxypyridine-2,5-diamine (PubChem CID 43260874) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-N-propan-2-yl-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-propan-2-yl-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 43260874 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-N-propan-2-yl-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NC(C)C)ccc1N |
| InChI | InChI=1S/C11H19N3O/c1-4-7-15-11-9(12)5-6-10(14-11)13-8(2)3/h5-6,8H,4,7,12H2,1-3H3,(H,13,14) |
| InChIKey | LFONFLSICANZDL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |