C11H17N3O — CID 43260902
2-N-cyclopropyl-6-propoxypyridine-2,5-diamine (PubChem CID 43260902) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-N-cyclopropyl-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-cyclopropyl-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 43260902 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-N-cyclopropyl-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NC2CC2)ccc1N |
| InChI | InChI=1S/C11H17N3O/c1-2-7-15-11-9(12)5-6-10(14-11)13-8-3-4-8/h5-6,8H,2-4,7,12H2,1H3,(H,13,14) |
| InChIKey | SXIAXTQVOGSYSX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |