C14H25N3O — CID 54954505
2-N-(2-methylpentan-3-yl)-6-propoxypyridine-2,5-diamine (PubChem CID 54954505) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-N-(2-methylpentan-3-yl)-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-(2-methylpentan-3-yl)-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 54954505 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-N-(2-methylpentan-3-yl)-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NC(CC)C(C)C)ccc1N |
| InChI | InChI=1S/C14H25N3O/c1-5-9-18-14-11(15)7-8-13(17-14)16-12(6-2)10(3)4/h7-8,10,12H,5-6,9,15H2,1-4H3,(H,16,17) |
| InChIKey | PSOABFZKMRVUFJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |