C13H19N5O — CID 106217168
6-propoxy-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine (PubChem CID 106217168) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 6-propoxy-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine.
| Compound Name | 6-propoxy-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 106217168 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 6-propoxy-2-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-2,5-diamine |
| SMILES | CCCOc1nc(NC(C)c2cn[nH]c2)ccc1N |
| InChI | InChI=1S/C13H19N5O/c1-3-6-19-13-11(14)4-5-12(18-13)17-9(2)10-7-15-16-8-10/h4-5,7-9H,3,6,14H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ATRGKSUTCZZSIT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |