C11H19N3OS — CID 63981193
6-ethoxy-2-N-(3-methylsulfanylpropyl)pyridine-2,5-diamine (PubChem CID 63981193) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 6-ethoxy-2-N-(3-methylsulfanylpropyl)pyridine-2,5-diamine.
| Compound Name | 6-ethoxy-2-N-(3-methylsulfanylpropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63981193 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 6-ethoxy-2-N-(3-methylsulfanylpropyl)pyridine-2,5-diamine |
| SMILES | CCOc1nc(NCCCSC)ccc1N |
| InChI | InChI=1S/C11H19N3OS/c1-3-15-11-9(12)5-6-10(14-11)13-7-4-8-16-2/h5-6H,3-4,7-8,12H2,1-2H3,(H,13,14) |
| InChIKey | ZGHVGUZBWINPKH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|