C12H21N3OS — CID 63982043
6-[(2-methylpropan-2-yl)oxy]-2-N-(2-methylsulfanylethyl)pyridine-2,5-diamine (PubChem CID 63982043) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxy]-2-N-(2-methylsulfanylethyl)pyridine-2,5-diamine.
| Compound Name | 6-[(2-methylpropan-2-yl)oxy]-2-N-(2-methylsulfanylethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63982043 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxy]-2-N-(2-methylsulfanylethyl)pyridine-2,5-diamine |
| SMILES | CSCCNc1ccc(N)c(OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N3OS/c1-12(2,3)16-11-9(13)5-6-10(15-11)14-7-8-17-4/h5-6H,7-8,13H2,1-4H3,(H,14,15) |
| InChIKey | DDWNKXCWFFBODV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|