C12H17F4N3O — CID 106289927
6-[(2-methylpropan-2-yl)oxy]-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine (PubChem CID 106289927) has the molecular formula C12H17F4N3O and a molecular weight of 295.28 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxy]-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine.
| Compound Name | 6-[(2-methylpropan-2-yl)oxy]-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 106289927 |
| Molecular Formula | C12H17F4N3O |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxy]-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine |
| SMILES | CC(C)(C)Oc1nc(NCC(F)(F)C(F)F)ccc1N |
| InChI | InChI=1S/C12H17F4N3O/c1-11(2,3)20-9-7(17)4-5-8(19-9)18-6-12(15,16)10(13)14/h4-5,10H,6,17H2,1-3H3,(H,18,19) |
| InChIKey | ZPDPWDJSKTZDBT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|