C12H21N3O2 — CID 43498929
2-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]propan-1-ol (PubChem CID 43498929) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 2-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 43498929 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-[[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]amino]propan-1-ol |
| SMILES | CC(CO)Nc1ccc(N)c(OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N3O2/c1-8(7-16)14-10-6-5-9(13)11(15-10)17-12(2,3)4/h5-6,8,16H,7,13H2,1-4H3,(H,14,15) |
| InChIKey | VDHOFGRYTVDLKI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |