C9H11F4N3O — CID 114169053
6-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine (PubChem CID 114169053) has the molecular formula C9H11F4N3O and a molecular weight of 253.20 g/mol. Its IUPAC name is 6-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine.
| Compound Name | 6-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114169053 |
| Molecular Formula | C9H11F4N3O |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 6-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine |
| SMILES | COc1nc(NCC(F)(F)C(F)F)ccc1N |
| InChI | InChI=1S/C9H11F4N3O/c1-17-7-5(14)2-3-6(16-7)15-4-9(12,13)8(10)11/h2-3,8H,4,14H2,1H3,(H,15,16) |
| InChIKey | HEZOJYGHIDYVFK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|