C10H12F4N2O — CID 106290004
4-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)benzene-1,2-diamine (PubChem CID 106290004) has the molecular formula C10H12F4N2O and a molecular weight of 252.21 g/mol. Its IUPAC name is 4-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)benzene-1,2-diamine.
| Compound Name | 4-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106290004 |
| Molecular Formula | C10H12F4N2O |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-methoxy-2-N-(2,2,3,3-tetrafluoropropyl)benzene-1,2-diamine |
| SMILES | COc1ccc(N)c(NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H12F4N2O/c1-17-6-2-3-7(15)8(4-6)16-5-10(13,14)9(11)12/h2-4,9,16H,5,15H2,1H3 |
| InChIKey | VRSLQYHSNLWANM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|