C9H8F7N3 — CID 106290011
4-N-(2,2,3,3-tetrafluoropropyl)-6-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 106290011) has the molecular formula C9H8F7N3 and a molecular weight of 291.17 g/mol. Its IUPAC name is 4-N-(2,2,3,3-tetrafluoropropyl)-6-(trifluoromethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(2,2,3,3-tetrafluoropropyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 106290011 |
| Molecular Formula | C9H8F7N3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-N-(2,2,3,3-tetrafluoropropyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnc(C(F)(F)F)cc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F7N3/c10-7(11)8(12,13)3-19-5-1-6(9(14,15)16)18-2-4(5)17/h1-2,7H,3,17H2,(H,18,19) |
| InChIKey | HRIVBCCGWVTSGN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|