About 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine
4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 106748056) has the molecular formula C11H16F3N3O
and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| PubChem CID | 106748056 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | CCOC(C)CNc1cc(C(F)(F)F)ncc1N |
| InChI | InChI=1S/C11H16F3N3O/c1-3-18-7(2)5-16-9-4-10(11(12,13)14)17-6-8(9)15/h4,6-7H,3,5,15H2,1-2H3,(H,16,17) |
| InChIKey | WCHDQSQNPJZOTJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine?
The IUPAC name of 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine (CID 106748056) is 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine.
What is the SMILES notation for 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine?
The canonical SMILES for 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine is CCOC(C)CNc1cc(C(F)(F)F)ncc1N.
What is the InChIKey of 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine?
The InChIKey is WCHDQSQNPJZOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O/c1-3-18-7(2)5-16-9-4-10(11(12,13)14)17-6-8(9)15/h4,6-7H,3,5,15H2,1-2H3,(H,16,17).
What are the key properties of 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine?
4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine has a molecular weight of 263.26 g/mol, XLogP of 2.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-ethoxypropyl)-6-(trifluoromethyl)pyridine-3,4-diamine is sourced from PubChem (CID 106748056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).