C10H15F3N4O2S — CID 106333885
N-[3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]propyl]methanesulfonamide (PubChem CID 106333885) has the molecular formula C10H15F3N4O2S and a molecular weight of 312.32 g/mol. Its IUPAC name is N-[3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106333885 |
| Molecular Formula | C10H15F3N4O2S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1cc(C(F)(F)F)ncc1N |
| InChI | InChI=1S/C10H15F3N4O2S/c1-20(18,19)17-4-2-3-15-8-5-9(10(11,12)13)16-6-7(8)14/h5-6,17H,2-4,14H2,1H3,(H,15,16) |
| InChIKey | QPEXFKGKQJFTPH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|