C11H14F3N3 — CID 106182590
4-N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 106182590) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 4-N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 106182590 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | CC(C)=CCNc1cc(C(F)(F)F)ncc1N |
| InChI | InChI=1S/C11H14F3N3/c1-7(2)3-4-16-9-5-10(11(12,13)14)17-6-8(9)15/h3,5-6H,4,15H2,1-2H3,(H,16,17) |
| InChIKey | ROARMSHMIXGHSJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|