C13H16F3N5 — CID 106747604
4-N-(4-imidazol-1-ylbutyl)-6-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 106747604) has the molecular formula C13H16F3N5 and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-N-(4-imidazol-1-ylbutyl)-6-(trifluoromethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(4-imidazol-1-ylbutyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 106747604 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-N-(4-imidazol-1-ylbutyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnc(C(F)(F)F)cc1NCCCCn1ccnc1 |
| InChI | InChI=1S/C13H16F3N5/c14-13(15,16)12-7-11(10(17)8-20-12)19-3-1-2-5-21-6-4-18-9-21/h4,6-9H,1-3,5,17H2,(H,19,20) |
| InChIKey | KJEKLBQDZMBKGP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|