C11H15FN6 — CID 80819497
5-fluoro-4-N-(4-imidazol-1-ylbutyl)pyrimidine-2,4-diamine (PubChem CID 80819497) has the molecular formula C11H15FN6 and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-fluoro-4-N-(4-imidazol-1-ylbutyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(4-imidazol-1-ylbutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80819497 |
| Molecular Formula | C11H15FN6 |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 5-fluoro-4-N-(4-imidazol-1-ylbutyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(F)c(NCCCCn2ccnc2)n1 |
| InChI | InChI=1S/C11H15FN6/c12-9-7-16-11(13)17-10(9)15-3-1-2-5-18-6-4-14-8-18/h4,6-8H,1-3,5H2,(H3,13,15,16,17) |
| InChIKey | GUCFHOLRUUINCR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|