C10H18FN5 — CID 80816916
4-N-[4-(dimethylamino)butyl]-5-fluoropyrimidine-2,4-diamine (PubChem CID 80816916) has the molecular formula C10H18FN5 and a molecular weight of 227.29 g/mol. Its IUPAC name is 4-N-[4-(dimethylamino)butyl]-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-(dimethylamino)butyl]-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80816916 |
| Molecular Formula | C10H18FN5 |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4-N-[4-(dimethylamino)butyl]-5-fluoropyrimidine-2,4-diamine |
| SMILES | CN(C)CCCCNc1nc(N)ncc1F |
| InChI | InChI=1S/C10H18FN5/c1-16(2)6-4-3-5-13-9-8(11)7-14-10(12)15-9/h7H,3-6H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | JVGRSDSEKNISEA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|