C15H19ClFN5 — CID 67281962
5-(3-chloro-2-fluorophenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine (PubChem CID 67281962) has the molecular formula C15H19ClFN5 and a molecular weight of 323.80 g/mol. Its IUPAC name is 5-(3-chloro-2-fluorophenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine.
| Compound Name | 5-(3-chloro-2-fluorophenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67281962 |
| Molecular Formula | C15H19ClFN5 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-(3-chloro-2-fluorophenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(N)ncc1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C15H19ClFN5/c1-22(2)8-4-7-19-14-11(9-20-15(18)21-14)10-5-3-6-12(16)13(10)17/h3,5-6,9H,4,7-8H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | YQLOJBWSGSTYER-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|