C9H14ClFN4 — CID 79081639
N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 79081639) has the molecular formula C9H14ClFN4 and a molecular weight of 232.69 g/mol. Its IUPAC name is N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79081639 |
| Molecular Formula | C9H14ClFN4 |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C9H14ClFN4/c1-15(2)5-3-4-12-8-7(11)6-13-9(10)14-8/h6H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | RWGVBEHFUATCFR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|