C12H22FN5 — CID 80777373
4-N-[3-(dimethylamino)propyl]-5-fluoro-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80777373) has the molecular formula C12H22FN5 and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-5-fluoro-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-5-fluoro-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80777373 |
| Molecular Formula | C12H22FN5 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-5-fluoro-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ncc(F)c(NCCCN(C)C)n1 |
| InChI | InChI=1S/C12H22FN5/c1-4-6-15-12-16-9-10(13)11(17-12)14-7-5-8-18(2)3/h9H,4-8H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | JQUDEVAXGLQBRJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|