C10H17FN4O — CID 80771875
3-[[5-fluoro-2-(propylamino)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 80771875) has the molecular formula C10H17FN4O and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-[[5-fluoro-2-(propylamino)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-fluoro-2-(propylamino)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 80771875 |
| Molecular Formula | C10H17FN4O |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-[[5-fluoro-2-(propylamino)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CCCNc1ncc(F)c(NCCCO)n1 |
| InChI | InChI=1S/C10H17FN4O/c1-2-4-13-10-14-7-8(11)9(15-10)12-5-3-6-16/h7,16H,2-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | IZKGDZKYFPNHAQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|