C10H16FN3O2 — CID 80866703
3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxypropan-1-ol (PubChem CID 80866703) has the molecular formula C10H16FN3O2 and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxypropan-1-ol.
| Compound Name | 3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 80866703 |
| Molecular Formula | C10H16FN3O2 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxypropan-1-ol |
| SMILES | CCCNc1ncc(F)c(OCCCO)n1 |
| InChI | InChI=1S/C10H16FN3O2/c1-2-4-12-10-13-7-8(11)9(14-10)16-6-3-5-15/h7,15H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | RBAPARAIUBXVGE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|