C9H14FN3OS — CID 80885067
2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanylethanol (PubChem CID 80885067) has the molecular formula C9H14FN3OS and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanylethanol.
| Compound Name | 2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanylethanol |
|---|---|
| PubChem CID | 80885067 |
| Molecular Formula | C9H14FN3OS |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanylethanol |
| SMILES | CCCNc1ncc(F)c(SCCO)n1 |
| InChI | InChI=1S/C9H14FN3OS/c1-2-3-11-9-12-6-7(10)8(13-9)15-5-4-14/h6,14H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | BIUGPRFTLMVGCH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |