C14H15ClFN3S — CID 103291569
4-[(2-chlorophenyl)methylsulfanyl]-5-fluoro-N-propylpyrimidin-2-amine (PubChem CID 103291569) has the molecular formula C14H15ClFN3S and a molecular weight of 311.81 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylsulfanyl]-5-fluoro-N-propylpyrimidin-2-amine.
| Compound Name | 4-[(2-chlorophenyl)methylsulfanyl]-5-fluoro-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 103291569 |
| Molecular Formula | C14H15ClFN3S |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 4-[(2-chlorophenyl)methylsulfanyl]-5-fluoro-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(SCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H15ClFN3S/c1-2-7-17-14-18-8-12(16)13(19-14)20-9-10-5-3-4-6-11(10)15/h3-6,8H,2,7,9H2,1H3,(H,17,18,19) |
| InChIKey | LHQBCVDDZLIHGV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |