C17H21ClN2S — CID 103290770
N-[[6-[(2-chlorophenyl)methylsulfanyl]-5-methyl-3-pyridinyl]methyl]propan-1-amine (PubChem CID 103290770) has the molecular formula C17H21ClN2S and a molecular weight of 320.89 g/mol. Its IUPAC name is N-[[6-[(2-chlorophenyl)methylsulfanyl]-5-methyl-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(2-chlorophenyl)methylsulfanyl]-5-methyl-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103290770 |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-[[6-[(2-chlorophenyl)methylsulfanyl]-5-methyl-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(SCc2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H21ClN2S/c1-3-8-19-10-14-9-13(2)17(20-11-14)21-12-15-6-4-5-7-16(15)18/h4-7,9,11,19H,3,8,10,12H2,1-2H3 |
| InChIKey | DMWKNZJIPRDPAX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|