C14H15BrClN3S — CID 114793039
5-bromo-4-[(4-chlorophenyl)methylsulfanyl]-N-propylpyrimidin-2-amine (PubChem CID 114793039) has the molecular formula C14H15BrClN3S and a molecular weight of 372.72 g/mol. Its IUPAC name is 5-bromo-4-[(4-chlorophenyl)methylsulfanyl]-N-propylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-[(4-chlorophenyl)methylsulfanyl]-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 114793039 |
| Molecular Formula | C14H15BrClN3S |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 5-bromo-4-[(4-chlorophenyl)methylsulfanyl]-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(Br)c(SCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H15BrClN3S/c1-2-7-17-14-18-8-12(15)13(19-14)20-9-10-3-5-11(16)6-4-10/h3-6,8H,2,7,9H2,1H3,(H,17,18,19) |
| InChIKey | CMVJKSYSODLWNX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |