C11H10BrClN4S — CID 80890895
5-bromo-4-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-2-amine (PubChem CID 80890895) has the molecular formula C11H10BrClN4S and a molecular weight of 345.65 g/mol. Its IUPAC name is 5-bromo-4-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80890895 |
| Molecular Formula | C11H10BrClN4S |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 5-bromo-4-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(Br)c(Sc2ccc(Cl)cn2)n1 |
| InChI | InChI=1S/C11H10BrClN4S/c1-2-14-11-16-6-8(12)10(17-11)18-9-4-3-7(13)5-15-9/h3-6H,2H2,1H3,(H,14,16,17) |
| InChIKey | PJVIWKSJZUMGLO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |