C11H11ClN4S — CID 80890451
6-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-4-amine (PubChem CID 80890451) has the molecular formula C11H11ClN4S and a molecular weight of 266.76 g/mol. Its IUPAC name is 6-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-4-amine.
| Compound Name | 6-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80890451 |
| Molecular Formula | C11H11ClN4S |
| Molecular Weight | 266.76 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-[(5-chloro-2-pyridinyl)sulfanyl]-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(Sc2ccc(Cl)cn2)ncn1 |
| InChI | InChI=1S/C11H11ClN4S/c1-2-13-9-5-11(16-7-15-9)17-10-4-3-8(12)6-14-10/h3-7H,2H2,1H3,(H,13,15,16) |
| InChIKey | RYTNKBLMURHJMV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |