C11H12BrN5S — CID 80889111
5-bromo-N-propyl-4-pyrimidin-4-ylsulfanylpyrimidin-2-amine (PubChem CID 80889111) has the molecular formula C11H12BrN5S and a molecular weight of 326.22 g/mol. Its IUPAC name is 5-bromo-N-propyl-4-pyrimidin-4-ylsulfanylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-propyl-4-pyrimidin-4-ylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80889111 |
| Molecular Formula | C11H12BrN5S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 5-bromo-N-propyl-4-pyrimidin-4-ylsulfanylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(Br)c(Sc2ccncn2)n1 |
| InChI | InChI=1S/C11H12BrN5S/c1-2-4-14-11-15-6-8(12)10(17-11)18-9-3-5-13-7-16-9/h3,5-7H,2,4H2,1H3,(H,14,15,17) |
| InChIKey | JBGZDEBRTGDIMO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |