C11H12FN5S — CID 80889363
5-fluoro-N-propyl-4-pyrazin-2-ylsulfanylpyrimidin-2-amine (PubChem CID 80889363) has the molecular formula C11H12FN5S and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-fluoro-N-propyl-4-pyrazin-2-ylsulfanylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-propyl-4-pyrazin-2-ylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80889363 |
| Molecular Formula | C11H12FN5S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 5-fluoro-N-propyl-4-pyrazin-2-ylsulfanylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(Sc2cnccn2)n1 |
| InChI | InChI=1S/C11H12FN5S/c1-2-3-15-11-16-6-8(12)10(17-11)18-9-7-13-4-5-14-9/h4-7H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | FLWXVJZGGCEQPU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |