C15H19N5S — CID 80995160
2-cyclopropyl-5-methyl-N-propyl-6-pyrazin-2-ylsulfanylpyrimidin-4-amine (PubChem CID 80995160) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-cyclopropyl-5-methyl-N-propyl-6-pyrazin-2-ylsulfanylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-5-methyl-N-propyl-6-pyrazin-2-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80995160 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-cyclopropyl-5-methyl-N-propyl-6-pyrazin-2-ylsulfanylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C2CC2)nc(Sc2cnccn2)c1C |
| InChI | InChI=1S/C15H19N5S/c1-3-6-18-13-10(2)15(20-14(19-13)11-4-5-11)21-12-9-16-7-8-17-12/h7-9,11H,3-6H2,1-2H3,(H,18,19,20) |
| InChIKey | LPUCPXJNXLBMMO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |