C15H19N3S2 — CID 80990970
2-cyclopropyl-5-methyl-N-propyl-6-thiophen-2-ylsulfanylpyrimidin-4-amine (PubChem CID 80990970) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-cyclopropyl-5-methyl-N-propyl-6-thiophen-2-ylsulfanylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-5-methyl-N-propyl-6-thiophen-2-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80990970 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-cyclopropyl-5-methyl-N-propyl-6-thiophen-2-ylsulfanylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C2CC2)nc(Sc2cccs2)c1C |
| InChI | InChI=1S/C15H19N3S2/c1-3-8-16-13-10(2)15(20-12-5-4-9-19-12)18-14(17-13)11-6-7-11/h4-5,9,11H,3,6-8H2,1-2H3,(H,16,17,18) |
| InChIKey | DWFKOAMJCIZZLV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |